Products 952578-24-4
CAS 952578-24-4 is the registry number for (2E)-1-(4-Aminophenyl)-3-(4-fluorophenyl)prop-2-en-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(E)-1-(4-aminophenyl)-3-(4-fluorophenyl)prop-2-en-1-one (CAS 952578-24-4) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: (E)-1-(4-aminophenyl)-3-(4-fluorophenyl)prop-2-en-1-one. InChIKey: CGHSGKVDRBPTMC-XCVCLJGOSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | (E)-1-(4-aminophenyl)-3-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | CGHSGKVDRBPTMC-XCVCLJGOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)C2=CC=C(C=C2)N)F |
Computed by PubChem (NCBI)