cas: 312314-26-4 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-6-fluoro-1H-indole, 95%, 95% (CAS 312314-26-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJ8H-50mg |
| cas | 312314-26-4 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 482.00 Pln | |
| Chemat | 100mg | 779.60 Pln | |
| Chemat | 250mg | 1278.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-fluoro-4-phenylmethoxy-1H-indole (CAS 312314-26-4) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: 6-fluoro-4-phenylmethoxy-1H-indole. InChIKey: MKROWIBAAADFHD-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | 6-fluoro-4-phenylmethoxy-1H-indole |
| InChIKey | MKROWIBAAADFHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC3=C2C=CN3)F |
Computed by PubChem (NCBI)