cas: 2987-06-6 — see every product listed under this CAS number, including other names
4-(Benzyloxy)cyclohexanone 96% (CAS 2987-06-6) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A438192-1000g |
| cas | 2987-06-6 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 16412.62 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 654.06 Pln | |
| Ambeed | 100g | 2411.81 Pln | |
| Ambeed | 500g | 10282.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A438192 |
4-phenylmethoxycyclohexan-1-one (CAS 2987-06-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 4-phenylmethoxycyclohexan-1-one. InChIKey: FFGVIYUANJAFJS-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 4-phenylmethoxycyclohexan-1-one |
| InChIKey | FFGVIYUANJAFJS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCC1OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)