CAS 1152833-63-0 is the registry number for 4-Isopropoxyphenylcyclopropyl ketone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Cyclopropyl-(4-propan-2-yloxyphenyl)methanone (CAS 1152833-63-0) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: cyclopropyl-(4-propan-2-yloxyphenyl)methanone. InChIKey: STNRZNADQGAHEI-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | cyclopropyl-(4-propan-2-yloxyphenyl)methanone |
| InChIKey | STNRZNADQGAHEI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=O)C2CC2 |
Computed by PubChem (NCBI)