CAS 220875-85-4 is the registry number for 1-Benzylcyclopentanecarboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-benzylcyclopentane-1-carboxylic acid (CAS 220875-85-4) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 1-benzylcyclopentane-1-carboxylic acid. InChIKey: PJWROSNRJZXGHJ-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 1-benzylcyclopentane-1-carboxylic acid |
| InChIKey | PJWROSNRJZXGHJ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)