cas: 1218791-13-9 — see every product listed under this CAS number, including other names
4-(Benzyloxycarbonylamino)-2-fluorophenylboronic acid, pinacol ester, 95%, 95% (CAS 1218791-13-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BG4-250mg |
| cas | 1218791-13-9 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 328.40 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 100g | 1542.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 1218791-13-9) is a chemical compound with the molecular formula C20H23BFNO4 and a molecular weight of 371.2 g/mol. IUPAC name: benzyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: XPCYDSDRORRCFT-UHFFFAOYSA-N.
| Molecular formula | C20H23BFNO4 |
|---|---|
| Molecular weight | 371.2 g/mol |
| IUPAC name | benzyl N-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | XPCYDSDRORRCFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)