cas: 81998-05-2 — see every product listed under this CAS number, including other names
4-(Bromomethyl)-4'-methyl-2,2'-bipyridine, 97% (CAS 81998-05-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233396-100MG |
| cas | 81998-05-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1643.19 Pln | |
| Fluorochem | 1g | 4173.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[4-(bromomethyl)-2-pyridinyl]-4-methylpyridine (CAS 81998-05-2) is a chemical compound with the molecular formula C12H11BrN2 and a molecular weight of 263.13 g/mol. IUPAC name: 2-[4-(bromomethyl)-2-pyridinyl]-4-methylpyridine. InChIKey: HUJZHWSADZZJAB-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2 |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 2-[4-(bromomethyl)-2-pyridinyl]-4-methylpyridine |
| InChIKey | HUJZHWSADZZJAB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=NC=CC(=C2)CBr |
Computed by PubChem (NCBI)