CAS 941294-39-9 is the registry number for 5-Bromo-4-(2,4-dimethylphenyl)pyrimidine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 100g, 5g.
5-bromo-4-(2,4-dimethylphenyl)pyrimidine (CAS 941294-39-9) is a chemical compound with the molecular formula C12H11BrN2 and a molecular weight of 263.13 g/mol. IUPAC name: 5-bromo-4-(2,4-dimethylphenyl)pyrimidine. InChIKey: LRFKWDZZXGCVPK-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2 |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 5-bromo-4-(2,4-dimethylphenyl)pyrimidine |
| InChIKey | LRFKWDZZXGCVPK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=NC=NC=C2Br)C |
Computed by PubChem (NCBI)