CAS 660432-31-5 is the registry number for 3-Bromo-2-phenyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-phenyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole (CAS 660432-31-5) is a chemical compound with the molecular formula C12H11BrN2 and a molecular weight of 263.13 g/mol. IUPAC name: 3-bromo-2-phenyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole. InChIKey: QZODCBKAOONTFM-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN2 |
|---|---|
| Molecular weight | 263.13 g/mol |
| IUPAC name | 3-bromo-2-phenyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole |
| InChIKey | QZODCBKAOONTFM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=NN2C1)C3=CC=CC=C3)Br |
Computed by PubChem (NCBI)