cas: 3446-91-1 — see every product listed under this CAS number, including other names
4-(Bromomethyl)-N,N-dimethylbenzenesulfonamide, 95%, 95% (CAS 3446-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CJEU-100mg |
| cas | 3446-91-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1211.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(bromomethyl)-N,N-dimethylbenzenesulfonamide (CAS 3446-91-1) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: 4-(bromomethyl)-N,N-dimethylbenzenesulfonamide. InChIKey: KTFSQBCKLKHZRU-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | 4-(bromomethyl)-N,N-dimethylbenzenesulfonamide |
| InChIKey | KTFSQBCKLKHZRU-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)CBr |
Computed by PubChem (NCBI)