CAS 3476-19-5 appears in our catalog under these names: 4-Bromo-N-propylbenzenesulfonamide, 95%, 4-Bromo-N-propylbenzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 2,5g.
4-bromo-N-propylbenzenesulfonamide (CAS 3476-19-5) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: 4-bromo-N-propylbenzenesulfonamide. InChIKey: CZRKEJQELXKHAQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | 4-bromo-N-propylbenzenesulfonamide |
| InChIKey | CZRKEJQELXKHAQ-UHFFFAOYSA-N |
| SMILES | CCCNS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)