CAS 850429-65-1 is the registry number for N-Ethyl 3-bromo-4-methylbenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
3-bromo-N-ethyl-4-methylbenzenesulfonamide (CAS 850429-65-1) is a chemical compound with the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. IUPAC name: 3-bromo-N-ethyl-4-methylbenzenesulfonamide. InChIKey: XHGFQYXLKWCUJI-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2S |
|---|---|
| Molecular weight | 278.17 g/mol |
| IUPAC name | 3-bromo-N-ethyl-4-methylbenzenesulfonamide |
| InChIKey | XHGFQYXLKWCUJI-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=CC(=C(C=C1)C)Br |
Computed by PubChem (NCBI)