cas: 4771-31-7 — see every product listed under this CAS number, including other names
4-(Chloromethyl)-2-phenyl-1,3-thiazole, 97% (CAS 4771-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 10g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC18324CB |
| cas | 4771-31-7 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 386.90 Pln | |
| Thermo Scientific | 1g | 514.17 Pln | |
| Thermo Scientific | 10g | 2107.59 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-(chloromethyl)-2-phenyl-1,3-thiazole (CAS 4771-31-7) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 4-(chloromethyl)-2-phenyl-1,3-thiazole. InChIKey: SVEGSFSFMLCNFF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNS |
|---|---|
| Molecular weight | 209.70 g/mol |
| IUPAC name | 4-(chloromethyl)-2-phenyl-1,3-thiazole |
| InChIKey | SVEGSFSFMLCNFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)