CAS 4771-31-7 appears in our catalog under these names: 4-(Chloromethyl)-2-phenyl-1,3-thiazole, 95%, 4-(Chloromethyl)-2-phenyl-1,3-thiazole hydrochloride, 95%, 4–(Chloromethyl)–2–phenyl–1,3–thiazole, 4-(Chloromethyl)-2-phenyl-1,3-thiazole, 97% , 4-(Chloromethyl)-2-phenylthiazole 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Ambeed. Available pack sizes: 250mg, 5g, 1g, 10g, 25g.
4-(chloromethyl)-2-phenyl-1,3-thiazole (CAS 4771-31-7) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 4-(chloromethyl)-2-phenyl-1,3-thiazole. InChIKey: SVEGSFSFMLCNFF-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNS |
|---|---|
| Molecular weight | 209.70 g/mol |
| IUPAC name | 4-(chloromethyl)-2-phenyl-1,3-thiazole |
| InChIKey | SVEGSFSFMLCNFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)CCl |
Computed by PubChem (NCBI)