CAS 24840-75-3 is the registry number for 4-(4-Chlorophenyl)-2-methylthiazole, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g, 25g.
4-(4-chlorophenyl)-2-methyl-1,3-thiazole (CAS 24840-75-3) is a chemical compound with the molecular formula C10H8ClNS and a molecular weight of 209.70 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-methyl-1,3-thiazole. InChIKey: FOCILOSWFFTFNL-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNS |
|---|---|
| Molecular weight | 209.70 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-methyl-1,3-thiazole |
| InChIKey | FOCILOSWFFTFNL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)