cas: 103788-61-0 — see every product listed under this CAS number, including other names
4-(Chloromethyl)-5-methyl-2-phenyloxazole, 98%, 98% (CAS 103788-61-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119SO9-100mg |
| cas | 103788-61-0 |
| size | 100mg |
| availability | 0.65g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 500mg | 990.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(chloromethyl)-5-methyl-2-phenyl-1,3-oxazole (CAS 103788-61-0) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 4-(chloromethyl)-5-methyl-2-phenyl-1,3-oxazole. InChIKey: VCTKYTBWZTZPHF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 4-(chloromethyl)-5-methyl-2-phenyl-1,3-oxazole |
| InChIKey | VCTKYTBWZTZPHF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=CC=C2)CCl |
Computed by PubChem (NCBI)