CAS 53761-49-2 is the registry number for 7-Chloro-4,8-dimethyl-1,2-dihydroquinolin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
7-chloro-4,8-dimethyl-1H-quinolin-2-one (CAS 53761-49-2) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 7-chloro-4,8-dimethyl-1H-quinolin-2-one. InChIKey: UASKNUBMLMFPOP-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 7-chloro-4,8-dimethyl-1H-quinolin-2-one |
| InChIKey | UASKNUBMLMFPOP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=C1C=CC(=C2C)Cl |
Computed by PubChem (NCBI)