CAS 2138570-92-8 appears in our catalog under these names: 4-(Pyridin-3-yl)phenol hydrochloride, 95%, 4-(Pyridin-3-yl)phenol hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g.
4-pyridin-3-ylphenol;hydrochloride (CAS 2138570-92-8) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 4-pyridin-3-ylphenol;hydrochloride. InChIKey: AVSAVXAHMOIYKY-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 4-pyridin-3-ylphenol;hydrochloride |
| InChIKey | AVSAVXAHMOIYKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C=C2)O.Cl |
Computed by PubChem (NCBI)