cas: 30762-02-8 — see every product listed under this CAS number, including other names
4-(Cyclopentyloxy)benzoic acid 96% (CAS 30762-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A620841-100mg |
| cas | 30762-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 681.88 Pln | |
| Ambeed | 1g | 1699.81 Pln | |
| Ambeed | 5g | 5087.38 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A620841 |
4-cyclopentyloxybenzoic acid (CAS 30762-02-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 4-cyclopentyloxybenzoic acid. InChIKey: NSTJDFGPPOXIAT-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 4-cyclopentyloxybenzoic acid |
| InChIKey | NSTJDFGPPOXIAT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)