CAS 5463-97-8 appears in our catalog under these names: 2-(1-Hydroxycyclobutyl)-2-phenylacetic acid, 95%, Benzeneacetic acid, α-(1-hydroxycyclobutyl)-, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-(1-hydroxycyclobutyl)-2-phenylacetic acid (CAS 5463-97-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(1-hydroxycyclobutyl)-2-phenylacetic acid. InChIKey: AAEQHELGUQCYGL-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(1-hydroxycyclobutyl)-2-phenylacetic acid |
| InChIKey | AAEQHELGUQCYGL-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(C2=CC=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)