CAS 82553-56-8 appears in our catalog under these names: 2,2-Dimethylchroman-8-carboxylic Acid, 2,2–Dimethylchroman–8–carboxylic acid, 2,2-Dimethylchroman-8-carboxylic acid, 95%, 2,2-Dimethylchroman-8-carboxylic acid, 95+%, 2,2-Dimethylchroman-8-carboxylic acid, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 100mg, 1g, 250mg, 0,5g, 50mg.
2,2-dimethyl-3,4-dihydrochromene-8-carboxylic acid (CAS 82553-56-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2,2-dimethyl-3,4-dihydrochromene-8-carboxylic acid. InChIKey: CNNKZSZUCRDOIA-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2,2-dimethyl-3,4-dihydrochromene-8-carboxylic acid |
| InChIKey | CNNKZSZUCRDOIA-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C(=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)