cas: 827614-68-6 — see every product listed under this CAS number, including other names
4-(Cyclopropylaminocarbonyl)phenylboronic acid, pinacol ester, 96%, 96% (CAS 827614-68-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114790-1g |
| cas | 827614-68-6 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 842.00 Pln | |
| Chemat | 10g | 1389.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 827614-68-6) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: N-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: PXTNJXLWXIJJIM-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | N-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | PXTNJXLWXIJJIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)NC3CC3 |
Computed by PubChem (NCBI)