cas: 5519-23-3 — see every product listed under this CAS number, including other names
4-(Decyloxy)benzoic acid 98% (CAS 5519-23-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A113128-1g |
| cas | 5519-23-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A113128 |
4-decoxybenzoic acid (CAS 5519-23-3) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: 4-decoxybenzoic acid. InChIKey: NZNICZRIRMGOFG-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 4-decoxybenzoic acid |
| InChIKey | NZNICZRIRMGOFG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)