4-(Dimethylamino)-1-naphthoic acid, 95+%
cas: 78062-03-0 — see every product listed under this CAS number, including other names
4-(Dimethylamino)-1-naphthoic acid, 95+% (CAS 78062-03-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F240161-1G |
| cas | 78062-03-0 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2538.71 Pln | |
| Fluorochem | 5g | 6834.07 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 1021.19 Pln | |
| Ambeed | 5g | 3947.06 Pln | |
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1754.00 Pln | |
| Chemat | 5g | 4854.80 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 480.97 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 4251.86 Pln |
properties
| purity | 95+% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-(dimethylamino)naphthalene-1-carboxylic acid (CAS 78062-03-0) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 4-(dimethylamino)naphthalene-1-carboxylic acid. InChIKey: LZQKNRRVTOJUHQ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 4-(dimethylamino)naphthalene-1-carboxylic acid |
| InChIKey | LZQKNRRVTOJUHQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Dimethylamino)-1-naphthoic acid, 4-(dimethylamino)naphthalene-1-carboxylic acid, 4-Dimethylaminonaphthalene-1-carboxylic acid, 4-(dimethylamino)-1-naphthalenecarboxylic acid, 4-(dimethylamino)naphthalic acid, 4-dimethylamino-1-naphthoic acid, 4-(Dimethylamino)-1-naphthoic acid #, 4-dimethylaminonaphthalenecarboxylic acid, 4-(dimethylamino)naphthalenecarboxylic acid, 4-Dimethylamino-naphthalene-1-carboxylic acid