cas: 59935-39-6 — see every product listed under this CAS number, including other names
4-(Dimethylamino)-3-nitrobenzaldehyde, 98%, 98% (CAS 59935-39-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EDSI-1g |
| cas | 59935-39-6 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 266.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 100g | 3002.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(dimethylamino)-3-nitrobenzaldehyde (CAS 59935-39-6) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 4-(dimethylamino)-3-nitrobenzaldehyde. InChIKey: BMMZDXZYHYBOOQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 4-(dimethylamino)-3-nitrobenzaldehyde |
| InChIKey | BMMZDXZYHYBOOQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)