cas: 16611-56-6 — see every product listed under this CAS number, including other names
4-(Dimethylamino)-3-nitrobenzenesulfonamide, 95%, 95% (CAS 16611-56-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZ6C-250mg |
| cas | 16611-56-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1763.60 Pln | |
| Chemat | 5g | 6266.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(dimethylamino)-3-nitrobenzenesulfonamide (CAS 16611-56-6) is a chemical compound with the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. IUPAC name: 4-(dimethylamino)-3-nitrobenzenesulfonamide. InChIKey: MSXQRSWSBOLTQG-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 4-(dimethylamino)-3-nitrobenzenesulfonamide |
| InChIKey | MSXQRSWSBOLTQG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C=C1)S(=O)(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)