CAS 1006957-05-6 is the registry number for 2-{((3,5-Dimethyl-4-nitro-1H-pyrazol-1-yl)methyl)sulfanyl}acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]acetic acid (CAS 1006957-05-6) is a chemical compound with the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. IUPAC name: 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]acetic acid. InChIKey: JIBZDJWNVMUECW-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]acetic acid |
| InChIKey | JIBZDJWNVMUECW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CSCC(=O)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)