CAS 1639350-77-8 is the registry number for 4-(4-Nitro-1H-pyrazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(4-nitropyrazol-1-yl)thiane 1,1-dioxide (CAS 1639350-77-8) is a chemical compound with the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. IUPAC name: 4-(4-nitropyrazol-1-yl)thiane 1,1-dioxide. InChIKey: WHPNXSNFKAVLJP-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 4-(4-nitropyrazol-1-yl)thiane 1,1-dioxide |
| InChIKey | WHPNXSNFKAVLJP-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCC1N2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)