cas: 67472-44-0 — see every product listed under this CAS number, including other names
4-(Hydroxymethyl)benzenesulfonamide 95% (CAS 67472-44-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A691794-100mg |
| cas | 67472-44-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 1015.62 Pln | |
| Ambeed | 5g | 4058.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A691794 |
4-(hydroxymethyl)benzenesulfonamide (CAS 67472-44-0) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: 4-(hydroxymethyl)benzenesulfonamide. InChIKey: UULCVOIRJRJPQS-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 4-(hydroxymethyl)benzenesulfonamide |
| InChIKey | UULCVOIRJRJPQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)S(=O)(=O)N |
Computed by PubChem (NCBI)