CAS 24447-99-2 appears in our catalog under these names: N-Methylsulfanilic acid, 95%, 4-(Methylamino)benzenesulfonic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
4-(methylamino)benzenesulfonic acid (CAS 24447-99-2) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: 4-(methylamino)benzenesulfonic acid. InChIKey: QRAXZXPSAGQUNP-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 4-(methylamino)benzenesulfonic acid |
| InChIKey | QRAXZXPSAGQUNP-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)