CAS 133-78-8 appears in our catalog under these names: m-Toluidine-4-sulfonic acid, 95%, 4-Amino-2-methylbenzenesulfonic acid, 95%, m–Toluidine–4–sulfonic Acid, m-Toluidine-4-sulfonic Acid, >95.0%(T), M-Toluidine-4-Sulfonic Acid. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g, 1g.
4-amino-2-methylbenzenesulfonic acid (CAS 133-78-8) is a chemical compound with the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. IUPAC name: 4-amino-2-methylbenzenesulfonic acid. InChIKey: ZDIRCGKEOWZBIM-UHFFFAOYSA-N.
| Molecular formula | C7H9NO3S |
|---|---|
| Molecular weight | 187.22 g/mol |
| IUPAC name | 4-amino-2-methylbenzenesulfonic acid |
| InChIKey | ZDIRCGKEOWZBIM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)S(=O)(=O)O |
Computed by PubChem (NCBI)