cas: 179055-26-6 — see every product listed under this CAS number, including other names
4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid 98% (CAS 179055-26-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A767085-1g |
| cas | 179055-26-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A767085 |
[4-[methoxy(methyl)carbamoyl]phenyl]boronic acid (CAS 179055-26-6) is a chemical compound with the molecular formula C9H12BNO4 and a molecular weight of 209.01 g/mol. IUPAC name: [4-[methoxy(methyl)carbamoyl]phenyl]boronic acid. InChIKey: PISDDPDFGJLSQA-UHFFFAOYSA-N.
| Molecular formula | C9H12BNO4 |
|---|---|
| Molecular weight | 209.01 g/mol |
| IUPAC name | [4-[methoxy(methyl)carbamoyl]phenyl]boronic acid |
| InChIKey | PISDDPDFGJLSQA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N(C)OC)(O)O |
Computed by PubChem (NCBI)