cas: 1073353-58-8 — see every product listed under this CAS number, including other names
4-(N,O-Dimethylhydroxylaminocarbonyl)phenylboronic acid, pinacol ester, 98%, 98% (CAS 1073353-58-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114T6H-250mg |
| cas | 1073353-58-8 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 5g | 458.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073353-58-8) is a chemical compound with the molecular formula C15H22BNO4 and a molecular weight of 291.15 g/mol. IUPAC name: N-methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BILGGOPMWGNRQQ-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | N-methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BILGGOPMWGNRQQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N(C)OC |
Computed by PubChem (NCBI)