cas: 1073353-58-8 — see every product listed under this CAS number, including other names
N-Methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide 98% (CAS 1073353-58-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A732647-250mg |
| cas | 1073353-58-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2634.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A732647 |
N-methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1073353-58-8) is a chemical compound with the molecular formula C15H22BNO4 and a molecular weight of 291.15 g/mol. IUPAC name: N-methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: BILGGOPMWGNRQQ-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | N-methoxy-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | BILGGOPMWGNRQQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)N(C)OC |
Computed by PubChem (NCBI)