CAS 773872-73-4 appears in our catalog under these names: 4-(Pentafluorosulfur)benzyl alcohol, 95%, 4-(Pentafluorosulfur)benzyl alcohol, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
[4-(pentafluoro-lambda6-sulfanyl)phenyl]methanol (CAS 773872-73-4) is a chemical compound with the molecular formula C7H7F5OS and a molecular weight of 234.19 g/mol. IUPAC name: [4-(pentafluoro-lambda6-sulfanyl)phenyl]methanol. InChIKey: QKEQGUCFBIRBAU-UHFFFAOYSA-N.
| Molecular formula | C7H7F5OS |
|---|---|
| Molecular weight | 234.19 g/mol |
| IUPAC name | [4-(pentafluoro-lambda6-sulfanyl)phenyl]methanol |
| InChIKey | QKEQGUCFBIRBAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)