CAS 852469-75-1 appears in our catalog under these names: 1-Methoxy-4-(pentafluorosulfanyl)benzene, 95%, 95%, 4-Methoxyphenylsulphur pentafluoride, 97%, Pentafluoro(4-methoxyphenyl)-lambda6-sulfane, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
Pentafluoro-(4-methoxyphenyl)-lambda6-sulfane (CAS 852469-75-1) is a chemical compound with the molecular formula C7H7F5OS and a molecular weight of 234.19 g/mol. IUPAC name: pentafluoro-(4-methoxyphenyl)-lambda6-sulfane. InChIKey: HVEWPNYILHLGKS-UHFFFAOYSA-N.
| Molecular formula | C7H7F5OS |
|---|---|
| Molecular weight | 234.19 g/mol |
| IUPAC name | pentafluoro-(4-methoxyphenyl)-lambda6-sulfane |
| InChIKey | HVEWPNYILHLGKS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)