CAS 1272542-23-0 appears in our catalog under these names: 1-Methoxy-3-(pentafluorosulfanyl)benzene, 95%, (OC-​6-​21)​-Pentafluoro(3-​methoxyphenyl)​-​sulfur, 3-Methoxyphenylsulphur pentafluoride, 97%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 500mg.
Pentafluoro-(3-methoxyphenyl)-lambda6-sulfane (CAS 1272542-23-0) is a chemical compound with the molecular formula C7H7F5OS and a molecular weight of 234.19 g/mol. IUPAC name: pentafluoro-(3-methoxyphenyl)-lambda6-sulfane. InChIKey: AQYKUTZKSQCGIC-UHFFFAOYSA-N.
| Molecular formula | C7H7F5OS |
|---|---|
| Molecular weight | 234.19 g/mol |
| IUPAC name | pentafluoro-(3-methoxyphenyl)-lambda6-sulfane |
| InChIKey | AQYKUTZKSQCGIC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)