cas: 122-37-2 — see every product listed under this CAS number, including other names
4-(Phenylamino)phenol, 98%, 98% (CAS 122-37-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127JF-1g |
| cas | 122-37-2 |
| size | 1g |
| availability | 439g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 50g | 290.00 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 250g | 890.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-Hydroxydiphenylamine is primary aromatic intermediate in the degradation of 6PPD.
Source: ChEBI
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-anilinophenol |
| InChIKey | JTTMYKSFKOOQLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)