cas: 122-37-2 — see every product listed under this CAS number, including other names
4-Hydroxydiphenylamine, 98.02% (CAS 122-37-2) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 5 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W088320-10mM/1mL |
| cas | 122-37-2 |
| size | 10mM/1mL |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 25 g | 384.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.02% |
4-Hydroxydiphenylamine is primary aromatic intermediate in the degradation of 6PPD.
Source: ChEBI
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-anilinophenol |
| InChIKey | JTTMYKSFKOOQLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)