cas: 1208-88-4 — see every product listed under this CAS number, including other names
4-(Phenylthio)benzaldehyde 95% (CAS 1208-88-4) is a chemical reagent available from Chemat. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A200374-500g |
| cas | 1208-88-4 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 8241.31 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 776.44 Pln | |
| Ambeed | 100g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A200374 |
4-phenylsulfanylbenzaldehyde (CAS 1208-88-4) is a chemical compound with the molecular formula C13H10OS and a molecular weight of 214.28 g/mol. IUPAC name: 4-phenylsulfanylbenzaldehyde. InChIKey: VDNBWBPUFMZCEW-UHFFFAOYSA-N.
| Molecular formula | C13H10OS |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | 4-phenylsulfanylbenzaldehyde |
| InChIKey | VDNBWBPUFMZCEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)