CAS 35813-68-4 appears in our catalog under these names: 2-Hydroxymethylnaphtho[1,2-b]thiophene, 95%, Naphtho(1,2–b)thiophen–2–ylmethanol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.
Benzo[g][1]benzothiol-2-ylmethanol (CAS 35813-68-4) is a chemical compound with the molecular formula C13H10OS and a molecular weight of 214.28 g/mol. IUPAC name: benzo[g][1]benzothiol-2-ylmethanol. InChIKey: HPYSRPMROPQUEF-UHFFFAOYSA-N.
| Molecular formula | C13H10OS |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | benzo[g][1]benzothiol-2-ylmethanol |
| InChIKey | HPYSRPMROPQUEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2SC(=C3)CO |
Computed by PubChem (NCBI)