CAS 3988-77-0 appears in our catalog under these names: 2-Cinnamoylthiophene, 98%, 2–Cinnamoylthiophene, 2-Cinnamoylthiophene, 3-Phenyl-1-(thiophen-2-yl)prop-2-en-1-one 98%, 3-Phenyl-1-(2-Thienyl)-2-Propen-1-One, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 100mg, 250mg.
(E)-3-phenyl-1-thiophen-2-ylprop-2-en-1-one (CAS 3988-77-0) is a chemical compound with the molecular formula C13H10OS and a molecular weight of 214.28 g/mol. IUPAC name: (E)-3-phenyl-1-thiophen-2-ylprop-2-en-1-one. InChIKey: DDNPADUKGZMCHV-CMDGGOBGSA-N.
| Molecular formula | C13H10OS |
|---|---|
| Molecular weight | 214.28 g/mol |
| IUPAC name | (E)-3-phenyl-1-thiophen-2-ylprop-2-en-1-one |
| InChIKey | DDNPADUKGZMCHV-CMDGGOBGSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)