cas: 634468-72-7 — see every product listed under this CAS number, including other names
4-(Piperazin-1-yl)pyrimidine dihydrochloride, 95%, 95% (CAS 634468-72-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EICU-100mg |
| cas | 634468-72-7 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 347.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-piperazin-1-ylpyrimidine;dihydrochloride (CAS 634468-72-7) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 4-piperazin-1-ylpyrimidine;dihydrochloride. InChIKey: HJUFMYKBVXHYEN-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 4-piperazin-1-ylpyrimidine;dihydrochloride |
| InChIKey | HJUFMYKBVXHYEN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)