CAS 1881292-75-6 appears in our catalog under these names: 4-(Piperazin-1-yl)pyridazine dihydrochloride, 95%, 4-(Piperazin-1-yl)pyridazine dihydrochloride, 4-(Piperazin-1-yl)pyridazine dihydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg.
4-piperazin-1-ylpyridazine;dihydrochloride (CAS 1881292-75-6) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 4-piperazin-1-ylpyridazine;dihydrochloride. InChIKey: PNMHRTUHGVYWIN-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 4-piperazin-1-ylpyridazine;dihydrochloride |
| InChIKey | PNMHRTUHGVYWIN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CN=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)