cas: 634468-72-7 — see every product listed under this CAS number, including other names
4-(Piperazin-1-yl)pyrimidine dihydrochloride, 95% (CAS 634468-72-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-2416-5g |
| cas | 634468-72-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| AmBeed | 5g | 786.10 Pln | |
| AmBeed | 250mg | 167.65 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 424.87 Pln | |
| Fluorochem | 5g | 1924.34 Pln | |
| Fluorochem | 10g | 3793.47 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-piperazin-1-ylpyrimidine;dihydrochloride (CAS 634468-72-7) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 4-piperazin-1-ylpyrimidine;dihydrochloride. InChIKey: HJUFMYKBVXHYEN-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 4-piperazin-1-ylpyrimidine;dihydrochloride |
| InChIKey | HJUFMYKBVXHYEN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)