CAS 202979-33-7 is the registry number for N-(4-(Aminomethyl)phenyl)guanidine Dihydrochloride. Offered by: TRC. Available pack sizes: 1g.
2-[4-(aminomethyl)phenyl]guanidine;dihydrochloride (CAS 202979-33-7) is a chemical compound with the molecular formula C8H14Cl2N4 and a molecular weight of 237.13 g/mol. IUPAC name: 2-[4-(aminomethyl)phenyl]guanidine;dihydrochloride. InChIKey: IHXURFIRYDRFTJ-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N4 |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 2-[4-(aminomethyl)phenyl]guanidine;dihydrochloride |
| InChIKey | IHXURFIRYDRFTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N=C(N)N.Cl.Cl |
Computed by PubChem (NCBI)