cas: 216060-23-0 — see every product listed under this CAS number, including other names
4-(Pyrazin-2-yl)benzoic acid 98% (CAS 216060-23-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A872622-100mg |
| cas | 216060-23-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 620.69 Pln | |
| Ambeed | 1g | 1405.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A872622 |
4-pyrazin-2-ylbenzoic acid (CAS 216060-23-0) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 4-pyrazin-2-ylbenzoic acid. InChIKey: DCCMRHMNLNXEDE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4-pyrazin-2-ylbenzoic acid |
| InChIKey | DCCMRHMNLNXEDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CN=C2)C(=O)O |
Computed by PubChem (NCBI)