CAS 96616-23-8 appears in our catalog under these names: 4-(Pyridin-2-ylmethyl)aniline dihydrochloride, 97%, 97%, [4-(2-pyridinylmethyl)phenyl]amine dihydrochloride, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-(pyridin-2-ylmethyl)aniline;dihydrochloride (CAS 96616-23-8) is a chemical compound with the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. IUPAC name: 4-(pyridin-2-ylmethyl)aniline;dihydrochloride. InChIKey: ZWXAJYVBYLQVQA-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 4-(pyridin-2-ylmethyl)aniline;dihydrochloride |
| InChIKey | ZWXAJYVBYLQVQA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CC2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)