Products 1236861-65-6
CAS 1236861-65-6 is the registry number for 2-(Azetidin-3-yl)quinoline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(azetidin-3-yl)quinoline;dihydrochloride (CAS 1236861-65-6) is a chemical compound with the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. IUPAC name: 2-(azetidin-3-yl)quinoline;dihydrochloride. InChIKey: KTRJVZSWODVJDK-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 2-(azetidin-3-yl)quinoline;dihydrochloride |
| InChIKey | KTRJVZSWODVJDK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=NC3=CC=CC=C3C=C2.Cl.Cl |
Computed by PubChem (NCBI)