CAS 2060040-93-7 is the registry number for 4-(Chloromethyl)-N,N-dimethylisoquinolin-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(chloromethyl)-N,N-dimethylisoquinolin-1-amine;hydrochloride (CAS 2060040-93-7) is a chemical compound with the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. IUPAC name: 4-(chloromethyl)-N,N-dimethylisoquinolin-1-amine;hydrochloride. InChIKey: DYBFCVQOCZZMQR-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 4-(chloromethyl)-N,N-dimethylisoquinolin-1-amine;hydrochloride |
| InChIKey | DYBFCVQOCZZMQR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C2=CC=CC=C21)CCl.Cl |
Computed by PubChem (NCBI)